C15H12Br2ClF2N — CID 106763062
N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromo-2-fluorophenyl)methyl]ethanamine (PubChem CID 106763062) has the molecular formula C15H12Br2ClF2N and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromo-2-fluorophenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromo-2-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106763062 |
| Molecular Formula | C15H12Br2ClF2N |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 436.90 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(5-bromo-2-fluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Br)ccc1F)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C15H12Br2ClF2N/c1-2-21-15(10-7-8(16)3-6-12(10)19)9-4-5-11(17)13(18)14(9)20/h3-7,15,21H,2H2,1H3 |
| InChIKey | SFQKXEUCWWGRKN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|