C16H16BrClFNS — CID 106764378
N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methylsulfanylphenyl)methyl]ethanamine (PubChem CID 106764378) has the molecular formula C16H16BrClFNS and a molecular weight of 388.73 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methylsulfanylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methylsulfanylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106764378 |
| Molecular Formula | C16H16BrClFNS |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methylsulfanylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccccc1SC)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C16H16BrClFNS/c1-3-20-16(10-6-4-5-7-13(10)21-2)11-8-9-12(17)14(18)15(11)19/h4-9,16,20H,3H2,1-2H3 |
| InChIKey | YZXKCSQILMZKEL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|