C17H18BrClFN — CID 106762298
N-[(4-bromo-3-chloro-2-fluorophenyl)-(4-ethylphenyl)methyl]ethanamine (PubChem CID 106762298) has the molecular formula C17H18BrClFN and a molecular weight of 370.69 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(4-ethylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(4-ethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106762298 |
| Molecular Formula | C17H18BrClFN |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(4-ethylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(CC)cc1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C17H18BrClFN/c1-3-11-5-7-12(8-6-11)17(21-4-2)13-9-10-14(18)15(19)16(13)20/h5-10,17,21H,3-4H2,1-2H3 |
| InChIKey | AVTPNOLBVYQZFG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|