C11H11BrClFN4 — CID 106762829
N-[(4-bromo-3-chloro-2-fluorophenyl)-(2H-triazol-4-yl)methyl]ethanamine (PubChem CID 106762829) has the molecular formula C11H11BrClFN4 and a molecular weight of 333.59 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(2H-triazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2H-triazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106762829 |
| Molecular Formula | C11H11BrClFN4 |
| Molecular Weight | 333.59 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2H-triazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1cn[nH]n1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C11H11BrClFN4/c1-2-15-11(8-5-16-18-17-8)6-3-4-7(12)9(13)10(6)14/h3-5,11,15H,2H2,1H3,(H,16,17,18) |
| InChIKey | QLZZYGHVRDAASG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|