C16H15Br2ClFN — CID 106764876
N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]ethanamine (PubChem CID 106764876) has the molecular formula C16H15Br2ClFN and a molecular weight of 435.56 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106764876 |
| Molecular Formula | C16H15Br2ClFN |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 432.92 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(C)ccc1Br)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C16H15Br2ClFN/c1-3-21-16(11-8-9(2)4-6-12(11)17)10-5-7-13(18)14(19)15(10)20/h4-8,16,21H,3H2,1-2H3 |
| InChIKey | XDAOWXOHJBBWOM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|