C14H12Br2ClFN2 — CID 106765528
[(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]hydrazine (PubChem CID 106765528) has the molecular formula C14H12Br2ClFN2 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]hydrazine.
| Compound Name | [(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106765528 |
| Molecular Formula | C14H12Br2ClFN2 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 419.90 |
| IUPAC Name | [(4-bromo-3-chloro-2-fluorophenyl)-(2-bromo-5-methylphenyl)methyl]hydrazine |
| SMILES | Cc1ccc(Br)c(C(NN)c2ccc(Br)c(Cl)c2F)c1 |
| InChI | InChI=1S/C14H12Br2ClFN2/c1-7-2-4-10(15)9(6-7)14(20-19)8-3-5-11(16)12(17)13(8)18/h2-6,14,20H,19H2,1H3 |
| InChIKey | MHHDMLKATJBWAT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|