C13H8BrClF4N2 — CID 106765223
[(4-bromo-3-chloro-2-fluorophenyl)-(3,4,5-trifluorophenyl)methyl]hydrazine (PubChem CID 106765223) has the molecular formula C13H8BrClF4N2 and a molecular weight of 383.57 g/mol. Its IUPAC name is [(4-bromo-3-chloro-2-fluorophenyl)-(3,4,5-trifluorophenyl)methyl]hydrazine.
| Compound Name | [(4-bromo-3-chloro-2-fluorophenyl)-(3,4,5-trifluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106765223 |
| Molecular Formula | C13H8BrClF4N2 |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | [(4-bromo-3-chloro-2-fluorophenyl)-(3,4,5-trifluorophenyl)methyl]hydrazine |
| SMILES | NNC(c1cc(F)c(F)c(F)c1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C13H8BrClF4N2/c14-7-2-1-6(11(18)10(7)15)13(21-20)5-3-8(16)12(19)9(17)4-5/h1-4,13,21H,20H2 |
| InChIKey | HTECOZFWMQWHNA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|