C10H13BrClFN2O2 — CID 106765325
[1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-dimethoxyethyl]hydrazine (PubChem CID 106765325) has the molecular formula C10H13BrClFN2O2 and a molecular weight of 327.58 g/mol. Its IUPAC name is [1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-dimethoxyethyl]hydrazine.
| Compound Name | [1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-dimethoxyethyl]hydrazine |
|---|---|
| PubChem CID | 106765325 |
| Molecular Formula | C10H13BrClFN2O2 |
| Molecular Weight | 327.58 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | [1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-dimethoxyethyl]hydrazine |
| SMILES | COC(OC)C(NN)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C10H13BrClFN2O2/c1-16-10(17-2)9(15-14)5-3-4-6(11)7(12)8(5)13/h3-4,9-10,15H,14H2,1-2H3 |
| InChIKey | SQDVEQWGMFUGPD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|