C12H16BrClFNO — CID 106764719
1-(4-bromo-3-chloro-2-fluorophenyl)-4-methoxypentan-1-amine (PubChem CID 106764719) has the molecular formula C12H16BrClFNO and a molecular weight of 324.62 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-4-methoxypentan-1-amine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-4-methoxypentan-1-amine |
|---|---|
| PubChem CID | 106764719 |
| Molecular Formula | C12H16BrClFNO |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-4-methoxypentan-1-amine |
| SMILES | COC(C)CCC(N)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C12H16BrClFNO/c1-7(17-2)3-6-10(16)8-4-5-9(13)11(14)12(8)15/h4-5,7,10H,3,6,16H2,1-2H3 |
| InChIKey | AFPWUOYNURKLHW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|