C14H20BrClFN3 — CID 106762883
1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine (PubChem CID 106762883) has the molecular formula C14H20BrClFN3 and a molecular weight of 364.69 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 106762883 |
| Molecular Formula | C14H20BrClFN3 |
| Molecular Weight | 364.69 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine |
| SMILES | CN1CCN(C)C(CC(N)c2ccc(Br)c(Cl)c2F)C1 |
| InChI | InChI=1S/C14H20BrClFN3/c1-19-5-6-20(2)9(8-19)7-12(18)10-3-4-11(15)13(16)14(10)17/h3-4,9,12H,5-8,18H2,1-2H3 |
| InChIKey | TXOBTTLTAYACRP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|