C12H14BrClFNO2S — CID 106764537
1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine (PubChem CID 106764537) has the molecular formula C12H14BrClFNO2S and a molecular weight of 370.67 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 106764537 |
| Molecular Formula | C12H14BrClFNO2S |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine |
| SMILES | NC(CC1CCS(=O)(=O)C1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C12H14BrClFNO2S/c13-9-2-1-8(12(15)11(9)14)10(16)5-7-3-4-19(17,18)6-7/h1-2,7,10H,3-6,16H2 |
| InChIKey | HTJWIJIXGGCTRQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|