C14H21NO2S — CID 105120200
1-(2,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine (PubChem CID 105120200) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 105120200 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(1,1-dioxothiolan-3-yl)ethanamine |
| SMILES | Cc1ccc(C)c(C(N)CC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-10-3-4-11(2)13(7-10)14(15)8-12-5-6-18(16,17)9-12/h3-4,7,12,14H,5-6,8-9,15H2,1-2H3 |
| InChIKey | OGALCZOXOXOOAV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |