C10H17N3O2S — CID 105148582
2-(1,1-dioxothiolan-3-yl)-1-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 105148582) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 105148582 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | Cn1nccc1C(N)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17N3O2S/c1-13-10(2-4-12-13)9(11)6-8-3-5-16(14,15)7-8/h2,4,8-9H,3,5-7,11H2,1H3 |
| InChIKey | VEKQUCNLVVFZMW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |