C11H17N3O3S — CID 105178630
2-(1,1-dioxothiolan-3-yl)-1-(3-methoxypyrazin-2-yl)ethanamine (PubChem CID 105178630) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(3-methoxypyrazin-2-yl)ethanamine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-methoxypyrazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 105178630 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-methoxypyrazin-2-yl)ethanamine |
| SMILES | COc1nccnc1C(N)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17N3O3S/c1-17-11-10(13-3-4-14-11)9(12)6-8-2-5-18(15,16)7-8/h3-4,8-9H,2,5-7,12H2,1H3 |
| InChIKey | MSEUYKQQFCNOFI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |