C10H18N4O2S — CID 114213581
2-(1,1-dioxothiolan-3-yl)-1-(3-ethyltriazol-4-yl)ethanamine (PubChem CID 114213581) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(3-ethyltriazol-4-yl)ethanamine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-ethyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 114213581 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-ethyltriazol-4-yl)ethanamine |
| SMILES | CCn1nncc1C(N)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N4O2S/c1-2-14-10(6-12-13-14)9(11)5-8-3-4-17(15,16)7-8/h6,8-9H,2-5,7,11H2,1H3 |
| InChIKey | ZMWOJIXCCPGQEM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |