C10H17N3O2S — CID 104941648
(1R)-1-[3-(1,1-dioxothiolan-3-yl)imidazol-4-yl]propan-1-amine (PubChem CID 104941648) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is (1R)-1-[3-(1,1-dioxothiolan-3-yl)imidazol-4-yl]propan-1-amine.
| Compound Name | (1R)-1-[3-(1,1-dioxothiolan-3-yl)imidazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 104941648 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (1R)-1-[3-(1,1-dioxothiolan-3-yl)imidazol-4-yl]propan-1-amine |
| SMILES | CC[C@@H](N)c1cncn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17N3O2S/c1-2-9(11)10-5-12-7-13(10)8-3-4-16(14,15)6-8/h5,7-9H,2-4,6,11H2,1H3/t8?,9-/m1/s1 |
| InChIKey | CDESMJSVICCGGL-YGPZHTELSA-N |
| XLogP | 0.65 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |