C8H13N3O2S — CID 130921357
1-[3-(1,1-dioxothietan-3-yl)imidazol-4-yl]ethanamine (PubChem CID 130921357) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 1-[3-(1,1-dioxothietan-3-yl)imidazol-4-yl]ethanamine.
| Compound Name | 1-[3-(1,1-dioxothietan-3-yl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 130921357 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-[3-(1,1-dioxothietan-3-yl)imidazol-4-yl]ethanamine |
| SMILES | CC(N)c1cncn1C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13N3O2S/c1-6(9)8-2-10-5-11(8)7-3-14(12,13)4-7/h2,5-7H,3-4,9H2,1H3 |
| InChIKey | ABGBLTGUOKRXIL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |