C11H19N3 — CID 104943969
(1S)-1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethanamine (PubChem CID 104943969) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (1S)-1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethanamine.
| Compound Name | (1S)-1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 104943969 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (1S)-1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethanamine |
| SMILES | CC1CCC(n2cncc2[C@H](C)N)C1 |
| InChI | InChI=1S/C11H19N3/c1-8-3-4-10(5-8)14-7-13-6-11(14)9(2)12/h6-10H,3-5,12H2,1-2H3/t8?,9-,10?/m0/s1 |
| InChIKey | BZWCIGHOQVCKGI-KYHHOPLUSA-N |
| XLogP | 2.26 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |