C13H23N3 — CID 104943263
(1R)-1-[3-(4,4-dimethylcyclohexyl)imidazol-4-yl]ethanamine (PubChem CID 104943263) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (1R)-1-[3-(4,4-dimethylcyclohexyl)imidazol-4-yl]ethanamine.
| Compound Name | (1R)-1-[3-(4,4-dimethylcyclohexyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 104943263 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (1R)-1-[3-(4,4-dimethylcyclohexyl)imidazol-4-yl]ethanamine |
| SMILES | C[C@@H](N)c1cncn1C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H23N3/c1-10(14)12-8-15-9-16(12)11-4-6-13(2,3)7-5-11/h8-11H,4-7,14H2,1-3H3/t10-/m1/s1 |
| InChIKey | WXLHNKFNIPDVQK-SNVBAGLBSA-N |
| XLogP | 3.04 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |