C14H24N2O3S — CID 105108962
1-(1,3-diethylpyrazol-5-yl)-3-(1,1-dioxothiolan-3-yl)propan-2-ol (PubChem CID 105108962) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)-3-(1,1-dioxothiolan-3-yl)propan-2-ol.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)-3-(1,1-dioxothiolan-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 105108962 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)-3-(1,1-dioxothiolan-3-yl)propan-2-ol |
| SMILES | CCc1cc(CC(O)CC2CCS(=O)(=O)C2)n(CC)n1 |
| InChI | InChI=1S/C14H24N2O3S/c1-3-12-8-13(16(4-2)15-12)9-14(17)7-11-5-6-20(18,19)10-11/h8,11,14,17H,3-7,9-10H2,1-2H3 |
| InChIKey | CNLGTDFMAYVPAM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |