C14H24N2OS — CID 114283090
2-(1,3-diethylpyrazol-5-yl)-1-(thian-3-yl)ethanol (PubChem CID 114283090) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-(1,3-diethylpyrazol-5-yl)-1-(thian-3-yl)ethanol.
| Compound Name | 2-(1,3-diethylpyrazol-5-yl)-1-(thian-3-yl)ethanol |
|---|---|
| PubChem CID | 114283090 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-(1,3-diethylpyrazol-5-yl)-1-(thian-3-yl)ethanol |
| SMILES | CCc1cc(CC(O)C2CCCSC2)n(CC)n1 |
| InChI | InChI=1S/C14H24N2OS/c1-3-12-8-13(16(4-2)15-12)9-14(17)11-6-5-7-18-10-11/h8,11,14,17H,3-7,9-10H2,1-2H3 |
| InChIKey | YRWSNHHRPZPBSO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |