C14H24FN3 — CID 112565553
3-[2-(1,3-diethylpyrazol-5-yl)-1-fluoroethyl]piperidine (PubChem CID 112565553) has the molecular formula C14H24FN3 and a molecular weight of 253.36 g/mol. Its IUPAC name is 3-[2-(1,3-diethylpyrazol-5-yl)-1-fluoroethyl]piperidine.
| Compound Name | 3-[2-(1,3-diethylpyrazol-5-yl)-1-fluoroethyl]piperidine |
|---|---|
| PubChem CID | 112565553 |
| Molecular Formula | C14H24FN3 |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3-[2-(1,3-diethylpyrazol-5-yl)-1-fluoroethyl]piperidine |
| SMILES | CCc1cc(CC(F)C2CCCNC2)n(CC)n1 |
| InChI | InChI=1S/C14H24FN3/c1-3-12-8-13(18(4-2)17-12)9-14(15)11-6-5-7-16-10-11/h8,11,14,16H,3-7,9-10H2,1-2H3 |
| InChIKey | CKHHTSDISWZVFC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |