C13H22FN3 — CID 112565336
3-[1-fluoro-2-(1-propylimidazol-2-yl)ethyl]piperidine (PubChem CID 112565336) has the molecular formula C13H22FN3 and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-[1-fluoro-2-(1-propylimidazol-2-yl)ethyl]piperidine.
| Compound Name | 3-[1-fluoro-2-(1-propylimidazol-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 112565336 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 3-[1-fluoro-2-(1-propylimidazol-2-yl)ethyl]piperidine |
| SMILES | CCCn1ccnc1CC(F)C1CCCNC1 |
| InChI | InChI=1S/C13H22FN3/c1-2-7-17-8-6-16-13(17)9-12(14)11-4-3-5-15-10-11/h6,8,11-12,15H,2-5,7,9-10H2,1H3 |
| InChIKey | VCEQYHLRVVZKFU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |