C16H30N4 — CID 105210397
[2-(1,3-diethylpyrazol-5-yl)-1-(3-methylcyclohexyl)ethyl]hydrazine (PubChem CID 105210397) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is [2-(1,3-diethylpyrazol-5-yl)-1-(3-methylcyclohexyl)ethyl]hydrazine.
| Compound Name | [2-(1,3-diethylpyrazol-5-yl)-1-(3-methylcyclohexyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105210397 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | [2-(1,3-diethylpyrazol-5-yl)-1-(3-methylcyclohexyl)ethyl]hydrazine |
| SMILES | CCc1cc(CC(NN)C2CCCC(C)C2)n(CC)n1 |
| InChI | InChI=1S/C16H30N4/c1-4-14-10-15(20(5-2)19-14)11-16(18-17)13-8-6-7-12(3)9-13/h10,12-13,16,18H,4-9,11,17H2,1-3H3 |
| InChIKey | DPTFRLBVNFCEBU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|