C15H29N5O — CID 105247675
[2-(1,3-diethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine (PubChem CID 105247675) has the molecular formula C15H29N5O and a molecular weight of 295.43 g/mol. Its IUPAC name is [2-(1,3-diethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(1,3-diethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105247675 |
| Molecular Formula | C15H29N5O |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | [2-(1,3-diethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine |
| SMILES | CCc1cc(CC(NN)C2CN(CC)CCO2)n(CC)n1 |
| InChI | InChI=1S/C15H29N5O/c1-4-12-9-13(20(6-3)18-12)10-14(17-16)15-11-19(5-2)7-8-21-15/h9,14-15,17H,4-8,10-11,16H2,1-3H3 |
| InChIKey | QIGFTELWTUJDDD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|