C11H22N6O — CID 105247553
[1-(4-ethylmorpholin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105247553) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is [1-(4-ethylmorpholin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(4-ethylmorpholin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105247553 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | [1-(4-ethylmorpholin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCN1CCOC(C(Cc2ncnn2C)NN)C1 |
| InChI | InChI=1S/C11H22N6O/c1-3-17-4-5-18-10(7-17)9(15-12)6-11-13-8-14-16(11)2/h8-10,15H,3-7,12H2,1-2H3 |
| InChIKey | DPABSIJZLPNQCZ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|