C14H21F2N3O — CID 105247727
[2-(2,6-difluorophenyl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine (PubChem CID 105247727) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2,6-difluorophenyl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105247727 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | [2-(2,6-difluorophenyl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine |
| SMILES | CCN1CCOC(C(Cc2c(F)cccc2F)NN)C1 |
| InChI | InChI=1S/C14H21F2N3O/c1-2-19-6-7-20-14(9-19)13(18-17)8-10-11(15)4-3-5-12(10)16/h3-5,13-14,18H,2,6-9,17H2,1H3 |
| InChIKey | ISNOXPOVYSPGIN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|