C15H23F2N3O — CID 105248189
[2-(2,3-difluorophenyl)-1-(4-propan-2-ylmorpholin-2-yl)ethyl]hydrazine (PubChem CID 105248189) has the molecular formula C15H23F2N3O and a molecular weight of 299.37 g/mol. Its IUPAC name is [2-(2,3-difluorophenyl)-1-(4-propan-2-ylmorpholin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2,3-difluorophenyl)-1-(4-propan-2-ylmorpholin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105248189 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | [2-(2,3-difluorophenyl)-1-(4-propan-2-ylmorpholin-2-yl)ethyl]hydrazine |
| SMILES | CC(C)N1CCOC(C(Cc2cccc(F)c2F)NN)C1 |
| InChI | InChI=1S/C15H23F2N3O/c1-10(2)20-6-7-21-14(9-20)13(19-18)8-11-4-3-5-12(16)15(11)17/h3-5,10,13-14,19H,6-9,18H2,1-2H3 |
| InChIKey | FSKJSSABDBZWHZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|