C13H24ClN5O — CID 105247717
[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine (PubChem CID 105247717) has the molecular formula C13H24ClN5O and a molecular weight of 301.82 g/mol. Its IUPAC name is [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105247717 |
| Molecular Formula | C13H24ClN5O |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(4-ethylmorpholin-2-yl)ethyl]hydrazine |
| SMILES | CCN1CCOC(C(Cc2c(Cl)c(C)nn2C)NN)C1 |
| InChI | InChI=1S/C13H24ClN5O/c1-4-19-5-6-20-12(8-19)10(16-15)7-11-13(14)9(2)17-18(11)3/h10,12,16H,4-8,15H2,1-3H3 |
| InChIKey | DUVVOTVHOLPJJC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|