C10H17ClN4 — CID 105202592
[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-cyclopropylethyl]hydrazine (PubChem CID 105202592) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-cyclopropylethyl]hydrazine.
| Compound Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-cyclopropylethyl]hydrazine |
|---|---|
| PubChem CID | 105202592 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-cyclopropylethyl]hydrazine |
| SMILES | Cc1nn(C)c(CC(NN)C2CC2)c1Cl |
| InChI | InChI=1S/C10H17ClN4/c1-6-10(11)9(15(2)14-6)5-8(13-12)7-3-4-7/h7-8,13H,3-5,12H2,1-2H3 |
| InChIKey | QPIKLTVUUYDUAY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|