C12H22N4 — CID 105340222
[1-cyclobutyl-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine (PubChem CID 105340222) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is [1-cyclobutyl-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-cyclobutyl-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105340222 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [1-cyclobutyl-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1CC(NN)C1CCC1 |
| InChI | InChI=1S/C12H22N4/c1-8-11(9(2)16(3)15-8)7-12(14-13)10-5-4-6-10/h10,12,14H,4-7,13H2,1-3H3 |
| InChIKey | RQSQRKXUVVRBPS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|