C9H17N3 — CID 23005892
1-(1,3,5-trimethylpyrazol-4-yl)propan-2-amine (PubChem CID 23005892) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)propan-2-amine.
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 23005892 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)propan-2-amine |
| SMILES | Cc1nn(C)c(C)c1CC(C)N |
| InChI | InChI=1S/C9H17N3/c1-6(10)5-9-7(2)11-12(4)8(9)3/h6H,5,10H2,1-4H3 |
| InChIKey | CFETTYQSJILJEY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |