C13H24N2O — CID 107894694
3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-2-ol (PubChem CID 107894694) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-2-ol.
| Compound Name | 3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-2-ol |
|---|---|
| PubChem CID | 107894694 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-2-ol |
| SMILES | CCCC(C)C(O)Cc1c(C)nn(C)c1C |
| InChI | InChI=1S/C13H24N2O/c1-6-7-9(2)13(16)8-12-10(3)14-15(5)11(12)4/h9,13,16H,6-8H2,1-5H3 |
| InChIKey | VDZNFMXZSCGOOC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |