C10H18N2S — CID 83930049
2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propane-1-thiol (PubChem CID 83930049) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propane-1-thiol.
| Compound Name | 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propane-1-thiol |
|---|---|
| PubChem CID | 83930049 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propane-1-thiol |
| SMILES | Cc1nn(C)c(C)c1CC(C)CS |
| InChI | InChI=1S/C10H18N2S/c1-7(6-13)5-10-8(2)11-12(4)9(10)3/h7,13H,5-6H2,1-4H3 |
| InChIKey | LXAVFJRDFVCYJS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|