C10H20N2 — CID 143917345
ethane;4-ethyl-1,3,5-trimethylpyrazole (PubChem CID 143917345) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is ethane;4-ethyl-1,3,5-trimethylpyrazole.
| Compound Name | ethane;4-ethyl-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 143917345 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | ethane;4-ethyl-1,3,5-trimethylpyrazole |
| SMILES | CC.CCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C8H14N2.C2H6/c1-5-8-6(2)9-10(4)7(8)3;1-2/h5H2,1-4H3;1-2H3 |
| InChIKey | HVXLIOPRYUHATO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |