4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid

C8H12N2O2 — CID 83695194

IUPAC4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid
SMILESCCc1c(C)nn(C)c1C(=O)O
InChIInChI=1S/C8H12N2O2/c1-4-6-5(2)9-10(3)7(6)8(11)12/h4H2,1-3H3,(H,11,12)
InChIKeyGBMNCQFQXDRATH-UHFFFAOYSA-N
MW168.20 g/mol
LogP0.99
Rot. Bonds2

About 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid

4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid (PubChem CID 83695194) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid.

Molecular Properties

Compound Name4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid
PubChem CID83695194
Molecular FormulaC8H12N2O2
Molecular Weight168.20 g/mol
Exact Mass168.09
IUPAC Name4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid
SMILESCCc1c(C)nn(C)c1C(=O)O
InChIInChI=1S/C8H12N2O2/c1-4-6-5(2)9-10(3)7(6)8(11)12/h4H2,1-3H3,(H,11,12)
InChIKeyGBMNCQFQXDRATH-UHFFFAOYSA-N
XLogP0.99
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.20
LogP ≤ 50.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid?
The IUPAC name of 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid (CID 83695194) is 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid.
What is the SMILES notation for 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid?
The canonical SMILES for 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid is CCc1c(C)nn(C)c1C(=O)O.
What is the InChIKey of 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid?
The InChIKey is GBMNCQFQXDRATH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-4-6-5(2)9-10(3)7(6)8(11)12/h4H2,1-3H3,(H,11,12).
What are the key properties of 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid?
4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid has a molecular weight of 168.20 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,3-dimethylpyrazole-5-carboxylic acid is sourced from PubChem (CID 83695194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).