C10H18N2O2 — CID 170618736
ethane;5-ethyl-1,4-dimethylpyrazole-3-carboxylic acid (PubChem CID 170618736) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is ethane;5-ethyl-1,4-dimethylpyrazole-3-carboxylic acid.
| Compound Name | ethane;5-ethyl-1,4-dimethylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 170618736 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | ethane;5-ethyl-1,4-dimethylpyrazole-3-carboxylic acid |
| SMILES | CC.CCc1c(C)c(C(=O)O)nn1C |
| InChI | InChI=1S/C8H12N2O2.C2H6/c1-4-6-5(2)7(8(11)12)9-10(6)3;1-2/h4H2,1-3H3,(H,11,12);1-2H3 |
| InChIKey | SDFJBCPFYMKTOK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |