C9H14N2O — CID 143368389
1-(5-ethyl-1,3-dimethylpyrazol-4-yl)ethanone (PubChem CID 143368389) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(5-ethyl-1,3-dimethylpyrazol-4-yl)ethanone.
| Compound Name | 1-(5-ethyl-1,3-dimethylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 143368389 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-(5-ethyl-1,3-dimethylpyrazol-4-yl)ethanone |
| SMILES | CCc1c(C(C)=O)c(C)nn1C |
| InChI | InChI=1S/C9H14N2O/c1-5-8-9(7(3)12)6(2)10-11(8)4/h5H2,1-4H3 |
| InChIKey | LMKNUWJHEVUDCT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |