C9H16N2 — CID 44720131
3,5-diethyl-1,4-dimethylpyrazole (PubChem CID 44720131) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3,5-diethyl-1,4-dimethylpyrazole.
| Compound Name | 3,5-diethyl-1,4-dimethylpyrazole |
|---|---|
| PubChem CID | 44720131 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3,5-diethyl-1,4-dimethylpyrazole |
| SMILES | CCc1nn(C)c(CC)c1C |
| InChI | InChI=1S/C9H16N2/c1-5-8-7(3)9(6-2)11(4)10-8/h5-6H2,1-4H3 |
| InChIKey | GAJSAMXMHYCOEY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |