About 3,5-diethyl-1,4-dimethylpyrazole
3,5-diethyl-1,4-dimethylpyrazole (PubChem CID 44720131) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 3,5-diethyl-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 3,5-diethyl-1,4-dimethylpyrazole |
| PubChem CID | 44720131 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3,5-diethyl-1,4-dimethylpyrazole |
| SMILES | CCc1nn(C)c(CC)c1C |
| InChI | InChI=1S/C9H16N2/c1-5-8-7(3)9(6-2)11(4)10-8/h5-6H2,1-4H3 |
| InChIKey | GAJSAMXMHYCOEY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diethyl-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-1,4-dimethylpyrazole?
The IUPAC name of 3,5-diethyl-1,4-dimethylpyrazole (CID 44720131) is 3,5-diethyl-1,4-dimethylpyrazole.
What is the SMILES notation for 3,5-diethyl-1,4-dimethylpyrazole?
The canonical SMILES for 3,5-diethyl-1,4-dimethylpyrazole is CCc1nn(C)c(CC)c1C.
What is the InChIKey of 3,5-diethyl-1,4-dimethylpyrazole?
The InChIKey is GAJSAMXMHYCOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-5-8-7(3)9(6-2)11(4)10-8/h5-6H2,1-4H3.
What are the key properties of 3,5-diethyl-1,4-dimethylpyrazole?
3,5-diethyl-1,4-dimethylpyrazole has a molecular weight of 152.24 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-1,4-dimethylpyrazole is sourced from PubChem (CID 44720131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).