C16H30N2 — CID 57481984
3,4,5-tributyl-1-methylpyrazole (PubChem CID 57481984) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 3,4,5-tributyl-1-methylpyrazole.
| Compound Name | 3,4,5-tributyl-1-methylpyrazole |
|---|---|
| PubChem CID | 57481984 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 3,4,5-tributyl-1-methylpyrazole |
| SMILES | CCCCc1nn(C)c(CCCC)c1CCCC |
| InChI | InChI=1S/C16H30N2/c1-5-8-11-14-15(12-9-6-2)17-18(4)16(14)13-10-7-3/h5-13H2,1-4H3 |
| InChIKey | AZFBTJGNCMXHTF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |