C21H36 — CID 123628431
1,3,5-tributyl-2,4,6-trimethylbenzene (PubChem CID 123628431) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 1,3,5-tributyl-2,4,6-trimethylbenzene.
| Compound Name | 1,3,5-tributyl-2,4,6-trimethylbenzene |
|---|---|
| PubChem CID | 123628431 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 1,3,5-tributyl-2,4,6-trimethylbenzene |
| SMILES | CCCCc1c(C)c(CCCC)c(C)c(CCCC)c1C |
| InChI | InChI=1S/C21H36/c1-7-10-13-19-16(4)20(14-11-8-2)18(6)21(17(19)5)15-12-9-3/h7-15H2,1-6H3 |
| InChIKey | IDVFALNBBDSHAF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |