C9H12Cl2N2 — CID 164864335
4-butyl-3,6-dichloro-5-methylpyridazine (PubChem CID 164864335) has the molecular formula C9H12Cl2N2 and a molecular weight of 219.11 g/mol. Its IUPAC name is 4-butyl-3,6-dichloro-5-methylpyridazine.
| Compound Name | 4-butyl-3,6-dichloro-5-methylpyridazine |
|---|---|
| PubChem CID | 164864335 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-butyl-3,6-dichloro-5-methylpyridazine |
| SMILES | CCCCc1c(Cl)nnc(Cl)c1C |
| InChI | InChI=1S/C9H12Cl2N2/c1-3-4-5-7-6(2)8(10)12-13-9(7)11/h3-5H2,1-2H3 |
| InChIKey | FNUPEQJGOHYGCN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |