C11H19N3 — CID 106659403
6-butyl-N,4,5-trimethylpyridazin-3-amine (PubChem CID 106659403) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 6-butyl-N,4,5-trimethylpyridazin-3-amine.
| Compound Name | 6-butyl-N,4,5-trimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 106659403 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 6-butyl-N,4,5-trimethylpyridazin-3-amine |
| SMILES | CCCCc1nnc(NC)c(C)c1C |
| InChI | InChI=1S/C11H19N3/c1-5-6-7-10-8(2)9(3)11(12-4)14-13-10/h5-7H2,1-4H3,(H,12,14) |
| InChIKey | JPNJQSHMCQTSAI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |