C12H21N3 — CID 106659375
3-butyl-N-ethyl-5,6-dimethylpyrazin-2-amine (PubChem CID 106659375) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-butyl-N-ethyl-5,6-dimethylpyrazin-2-amine.
| Compound Name | 3-butyl-N-ethyl-5,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 106659375 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-butyl-N-ethyl-5,6-dimethylpyrazin-2-amine |
| SMILES | CCCCc1nc(C)c(C)nc1NCC |
| InChI | InChI=1S/C12H21N3/c1-5-7-8-11-12(13-6-2)15-10(4)9(3)14-11/h5-8H2,1-4H3,(H,13,15) |
| InChIKey | MMFLMOXBASAHBF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |