C17H29N7 — CID 148836551
2-N,8-dibutyl-6-N-ethyl-4-N-methylpyrimido[5,4-d]pyrimidine-2,4,6-triamine (PubChem CID 148836551) has the molecular formula C17H29N7 and a molecular weight of 331.47 g/mol. Its IUPAC name is 2-N,8-dibutyl-6-N-ethyl-4-N-methylpyrimido[5,4-d]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N,8-dibutyl-6-N-ethyl-4-N-methylpyrimido[5,4-d]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 148836551 |
| Molecular Formula | C17H29N7 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 2-N,8-dibutyl-6-N-ethyl-4-N-methylpyrimido[5,4-d]pyrimidine-2,4,6-triamine |
| SMILES | CCCCNc1nc(NC)c2nc(NCC)nc(CCCC)c2n1 |
| InChI | InChI=1S/C17H29N7/c1-5-8-10-12-13-14(23-16(21-12)19-7-3)15(18-4)24-17(22-13)20-11-9-6-2/h5-11H2,1-4H3,(H,19,21,23)(H2,18,20,22,24) |
| InChIKey | OURXAFGJZTVYFL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|