C13H22N8O — CID 134520273
3-[[8-(ethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 134520273) has the molecular formula C13H22N8O and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-[[8-(ethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[8-(ethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 134520273 |
| Molecular Formula | C13H22N8O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 3-[[8-(ethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CCNc1nc(NC)nc2c(NCCCO)nc(NC)nc12 |
| InChI | InChI=1S/C13H22N8O/c1-4-16-10-8-9(19-12(14-2)20-10)11(17-6-5-7-22)21-13(15-3)18-8/h22H,4-7H2,1-3H3,(H2,14,16,19,20)(H2,15,17,18,21) |
| InChIKey | IOUJLDWYTOMBPF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|