C13H22N8O2 — CID 134520330
2-[[4-(2-methoxyethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-8-yl]amino]ethanol (PubChem CID 134520330) has the molecular formula C13H22N8O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[[4-(2-methoxyethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-8-yl]amino]ethanol.
| Compound Name | 2-[[4-(2-methoxyethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-8-yl]amino]ethanol |
|---|---|
| PubChem CID | 134520330 |
| Molecular Formula | C13H22N8O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-[[4-(2-methoxyethylamino)-2,6-bis(methylamino)pyrimido[5,4-d]pyrimidin-8-yl]amino]ethanol |
| SMILES | CNc1nc(NCCOC)c2nc(NC)nc(NCCO)c2n1 |
| InChI | InChI=1S/C13H22N8O2/c1-14-12-19-9-8(10(20-12)16-4-6-22)18-13(15-2)21-11(9)17-5-7-23-3/h22H,4-7H2,1-3H3,(H2,14,16,19,20)(H2,15,17,18,21) |
| InChIKey | MKKIJDANRQVSQN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|