C8H13BrN4O — CID 80771885
3-[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 80771885) has the molecular formula C8H13BrN4O and a molecular weight of 261.12 g/mol. Its IUPAC name is 3-[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 80771885 |
| Molecular Formula | C8H13BrN4O |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CNc1ncc(Br)c(NCCCO)n1 |
| InChI | InChI=1S/C8H13BrN4O/c1-10-8-12-5-6(9)7(13-8)11-3-2-4-14/h5,14H,2-4H2,1H3,(H2,10,11,12,13) |
| InChIKey | NRSCELZPNUOJPC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|