C10H17BrN4O — CID 80813067
5-bromo-4-N-(4-methoxybutyl)-2-N-methylpyrimidine-2,4-diamine (PubChem CID 80813067) has the molecular formula C10H17BrN4O and a molecular weight of 289.18 g/mol. Its IUPAC name is 5-bromo-4-N-(4-methoxybutyl)-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(4-methoxybutyl)-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80813067 |
| Molecular Formula | C10H17BrN4O |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-bromo-4-N-(4-methoxybutyl)-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1ncc(Br)c(NCCCCOC)n1 |
| InChI | InChI=1S/C10H17BrN4O/c1-12-10-14-7-8(11)9(15-10)13-5-3-4-6-16-2/h7H,3-6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | WPNWILUMLYJZER-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|