C10H16BrN3O2 — CID 103745831
5-bromo-4-methoxy-N-(4-methoxybutyl)pyrimidin-2-amine (PubChem CID 103745831) has the molecular formula C10H16BrN3O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(4-methoxybutyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(4-methoxybutyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 103745831 |
| Molecular Formula | C10H16BrN3O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5-bromo-4-methoxy-N-(4-methoxybutyl)pyrimidin-2-amine |
| SMILES | COCCCCNc1ncc(Br)c(OC)n1 |
| InChI | InChI=1S/C10H16BrN3O2/c1-15-6-4-3-5-12-10-13-7-8(11)9(14-10)16-2/h7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | OQKPPTPCUMYBCH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|